decyl decanoate


capryl caprate; decyl caprate; n-decyl caprate; decyl decanoate
Links:📏 NIST
CAS RN:[1654-86-0]
Formula:C20H40O2; 312.54 g/mol
InChiKey:XAKXZZPEUKNHMA-UHFFFAOYSA-N
SMILES:CCCCCCCCCCOC(=O)CCCCCCCCC
Molecular structure of decyl decanoate
Density:0.859 g/mL
Molar volume:364.0 mL/mol
Refractive index:1.442
Molecular refractive power:96.37 mL/mol
Melting point:10 °C

Isomers

butyl hexadecanoate
Molecular structure of butyl hexadecanoate
decyl decanoate
Molecular structure of decyl decanoate
eicosanoic acid
Molecular structure of eicosanoic acid
2-ethylhexyl dodecanoate
Molecular structure of 2-ethylhexyl dodecanoate
ethyl octadecanoate
Molecular structure of ethyl octadecanoate
methyl nonadecanoate
Molecular structure of methyl nonadecanoate
2-methylpropyl hexadecanoate
Molecular structure of 2-methylpropyl hexadecanoate
2-[(Z)-octadec-9-enoxy]ethanol
Molecular structure of 2-[(Z)-octadec-9-enoxy]ethanol
octadecyl acetate
Molecular structure of octadecyl acetate